C11H14FNO2S — CID 60623801
N-(2-fluorophenyl)-2-(3-hydroxypropylsulfanyl)acetamide (PubChem CID 60623801) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(3-hydroxypropylsulfanyl)acetamide.
| Compound Name | N-(2-fluorophenyl)-2-(3-hydroxypropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 60623801 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(2-fluorophenyl)-2-(3-hydroxypropylsulfanyl)acetamide |
| SMILES | O=C(CSCCCO)Nc1ccccc1F |
| InChI | InChI=1S/C11H14FNO2S/c12-9-4-1-2-5-10(9)13-11(15)8-16-7-3-6-14/h1-2,4-5,14H,3,6-8H2,(H,13,15) |
| InChIKey | SGANKTOFGAEUND-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|