C11H14FNO3S — CID 79683205
2-(2,3-dihydroxypropylsulfanyl)-N-(2-fluorophenyl)acetamide (PubChem CID 79683205) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 79683205 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CSCC(O)CO)Nc1ccccc1F |
| InChI | InChI=1S/C11H14FNO3S/c12-9-3-1-2-4-10(9)13-11(16)7-17-6-8(15)5-14/h1-4,8,14-15H,5-7H2,(H,13,16) |
| InChIKey | DIPJWKDRHSYACG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |