C11H13N3O3S2 — CID 79682658
2-(2,3-dihydroxypropylsulfanyl)-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide (PubChem CID 79682658) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide.
| Compound Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide |
|---|---|
| PubChem CID | 79682658 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-(2,3-dihydroxypropylsulfanyl)-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)acetamide |
| SMILES | O=C(CSCC(O)CO)Nc1cccc2c1N=S=N2 |
| InChI | InChI=1S/C11H13N3O3S2/c15-4-7(16)5-18-6-10(17)12-8-2-1-3-9-11(8)14-19-13-9/h1-3,7,15-16H,4-6H2,(H,12,17) |
| InChIKey | IJYGMUVRQWLBPR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |