C12H16FNO3 — CID 176680522
(5R)-N-(2-fluorophenyl)-5,6-dihydroxyhexanamide (PubChem CID 176680522) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is (5R)-N-(2-fluorophenyl)-5,6-dihydroxyhexanamide.
| Compound Name | (5R)-N-(2-fluorophenyl)-5,6-dihydroxyhexanamide |
|---|---|
| PubChem CID | 176680522 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (5R)-N-(2-fluorophenyl)-5,6-dihydroxyhexanamide |
| SMILES | O=C(CCC[C@@H](O)CO)Nc1ccccc1F |
| InChI | InChI=1S/C12H16FNO3/c13-10-5-1-2-6-11(10)14-12(17)7-3-4-9(16)8-15/h1-2,5-6,9,15-16H,3-4,7-8H2,(H,14,17)/t9-/m1/s1 |
| InChIKey | NVWKHNRLPGDOIY-SECBINFHSA-N |
| XLogP | 1.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |