C17H17FN2O2S2 — CID 17482942
2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-methylsulfanylphenyl)acetamide (PubChem CID 17482942) has the molecular formula C17H17FN2O2S2 and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 17482942 |
| Molecular Formula | C17H17FN2O2S2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-N-(4-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccc(NC(=O)CSCC(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H17FN2O2S2/c1-23-13-8-6-12(7-9-13)19-16(21)10-24-11-17(22)20-15-5-3-2-4-14(15)18/h2-9H,10-11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | SWYBSKPRVOPSGA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |