C20H20F4N2O2S2 — CID 4215969
2-[4-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanylbutylsulfanyl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 4215969) has the molecular formula C20H20F4N2O2S2 and a molecular weight of 460.52 g/mol. Its IUPAC name is 2-[4-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanylbutylsulfanyl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[4-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanylbutylsulfanyl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 4215969 |
| Molecular Formula | C20H20F4N2O2S2 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[4-[2-(2,4-difluoroanilino)-2-oxoethyl]sulfanylbutylsulfanyl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(CSCCCCSCC(=O)Nc1ccc(F)cc1F)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H20F4N2O2S2/c21-13-3-5-17(15(23)9-13)25-19(27)11-29-7-1-2-8-30-12-20(28)26-18-6-4-14(22)10-16(18)24/h3-6,9-10H,1-2,7-8,11-12H2,(H,25,27)(H,26,28) |
| InChIKey | LVADBJRXZVCKBG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|