C11H11F2NOS — CID 52644992
N-(2,4-difluorophenyl)-2-prop-2-enylsulfanylacetamide (PubChem CID 52644992) has the molecular formula C11H11F2NOS and a molecular weight of 243.28 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-prop-2-enylsulfanylacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-prop-2-enylsulfanylacetamide |
|---|---|
| PubChem CID | 52644992 |
| Molecular Formula | C11H11F2NOS |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-prop-2-enylsulfanylacetamide |
| SMILES | C=CCSCC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NOS/c1-2-5-16-7-11(15)14-10-4-3-8(12)6-9(10)13/h2-4,6H,1,5,7H2,(H,14,15) |
| InChIKey | CEWXBBROANWDIX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|