C11H11F2NO3S2 — CID 47052050
N-(2,4-difluorophenyl)sulfonyl-2-prop-2-enylsulfanylacetamide (PubChem CID 47052050) has the molecular formula C11H11F2NO3S2 and a molecular weight of 307.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)sulfonyl-2-prop-2-enylsulfanylacetamide.
| Compound Name | N-(2,4-difluorophenyl)sulfonyl-2-prop-2-enylsulfanylacetamide |
|---|---|
| PubChem CID | 47052050 |
| Molecular Formula | C11H11F2NO3S2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | N-(2,4-difluorophenyl)sulfonyl-2-prop-2-enylsulfanylacetamide |
| SMILES | C=CCSCC(=O)NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NO3S2/c1-2-5-18-7-11(15)14-19(16,17)10-4-3-8(12)6-9(10)13/h2-4,6H,1,5,7H2,(H,14,15) |
| InChIKey | SRVDOOIFCNVQMJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|