C11H13ClFNO4S3 — CID 106428409
3-fluoro-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzenesulfonyl chloride (PubChem CID 106428409) has the molecular formula C11H13ClFNO4S3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 3-fluoro-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 3-fluoro-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 106428409 |
| Molecular Formula | C11H13ClFNO4S3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 3-fluoro-4-(2-prop-2-enylsulfanylethylsulfamoyl)benzenesulfonyl chloride |
| SMILES | C=CCSCCNS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1F |
| InChI | InChI=1S/C11H13ClFNO4S3/c1-2-6-19-7-5-14-21(17,18)11-4-3-9(8-10(11)13)20(12,15)16/h2-4,8,14H,1,5-7H2 |
| InChIKey | CKDVVBCPMJHMMI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|