C12H15ClN2O4S2 — CID 103816251
4-chloro-2-methyl-5-nitro-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide (PubChem CID 103816251) has the molecular formula C12H15ClN2O4S2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-nitro-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide.
| Compound Name | 4-chloro-2-methyl-5-nitro-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103816251 |
| Molecular Formula | C12H15ClN2O4S2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 4-chloro-2-methyl-5-nitro-N-(2-prop-2-enylsulfanylethyl)benzenesulfonamide |
| SMILES | C=CCSCCNS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)cc1C |
| InChI | InChI=1S/C12H15ClN2O4S2/c1-3-5-20-6-4-14-21(18,19)12-8-11(15(16)17)10(13)7-9(12)2/h3,7-8,14H,1,4-6H2,2H3 |
| InChIKey | PVFLLFRQDMCNFE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|