C10H13ClN2O6S — CID 81042974
4-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 81042974) has the molecular formula C10H13ClN2O6S and a molecular weight of 324.74 g/mol. Its IUPAC name is 4-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 81042974 |
| Molecular Formula | C10H13ClN2O6S |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 4-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(Cl)c([N+](=O)[O-])cc1S(=O)(=O)NC(CO)CO |
| InChI | InChI=1S/C10H13ClN2O6S/c1-6-2-8(11)9(13(16)17)3-10(6)20(18,19)12-7(4-14)5-15/h2-3,7,12,14-15H,4-5H2,1H3 |
| InChIKey | AJYPUSRZLFDIFU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|