C12H15ClN2O4S — CID 81042814
4-chloro-N-(2,2-dimethylcyclopropyl)-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 81042814) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethylcyclopropyl)-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-(2,2-dimethylcyclopropyl)-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 81042814 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 4-chloro-N-(2,2-dimethylcyclopropyl)-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(Cl)c([N+](=O)[O-])cc1S(=O)(=O)NC1CC1(C)C |
| InChI | InChI=1S/C12H15ClN2O4S/c1-7-4-8(13)9(15(16)17)5-10(7)20(18,19)14-11-6-12(11,2)3/h4-5,11,14H,6H2,1-3H3 |
| InChIKey | ZJTQNAQQYGFJDO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|