C12H15F2N3O3S — CID 60895838
2,4-difluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 60895838) has the molecular formula C12H15F2N3O3S and a molecular weight of 319.33 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60895838 |
| Molecular Formula | C12H15F2N3O3S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2,4-difluoro-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C12H15F2N3O3S/c13-9-1-2-11(10(14)7-9)21(19,20)16-8-12(18)17-5-3-15-4-6-17/h1-2,7,15-16H,3-6,8H2 |
| InChIKey | MPEQNDJRFGJMPX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |