C10H17N5O3S — CID 104710214
2-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyrazole-3-sulfonamide (PubChem CID 104710214) has the molecular formula C10H17N5O3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyrazole-3-sulfonamide.
| Compound Name | 2-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104710214 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-methyl-N-(2-oxo-2-piperazin-1-ylethyl)pyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H17N5O3S/c1-14-10(2-3-12-14)19(17,18)13-8-9(16)15-6-4-11-5-7-15/h2-3,11,13H,4-8H2,1H3 |
| InChIKey | RCHCYDIOPSXOGJ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |