C10H19N3O3S — CID 113451663
N-(6-hydroxyhexyl)-2-methylpyrazole-3-sulfonamide (PubChem CID 113451663) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-(6-hydroxyhexyl)-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 113451663 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(6-hydroxyhexyl)-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NCCCCCCO |
| InChI | InChI=1S/C10H19N3O3S/c1-13-10(6-8-11-13)17(15,16)12-7-4-2-3-5-9-14/h6,8,12,14H,2-5,7,9H2,1H3 |
| InChIKey | UXJRARSJWCKAFF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|