C9H17N5O2S — CID 113444065
5-[(2-methylpyrazol-3-yl)sulfonylamino]pentanimidamide (PubChem CID 113444065) has the molecular formula C9H17N5O2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-[(2-methylpyrazol-3-yl)sulfonylamino]pentanimidamide.
| Compound Name | 5-[(2-methylpyrazol-3-yl)sulfonylamino]pentanimidamide |
|---|---|
| PubChem CID | 113444065 |
| Molecular Formula | C9H17N5O2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 5-[(2-methylpyrazol-3-yl)sulfonylamino]pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCNS(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C9H17N5O2S/c1-14-9(5-7-12-14)17(15,16)13-6-3-2-4-8(10)11/h5,7,13H,2-4,6H2,1H3,(H3,10,11) |
| InChIKey | JWMGJJGLBBBRDV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|