C10H18ClN3O2S — CID 106158843
N-(5-chloro-4-methylpentyl)-2-methylpyrazole-3-sulfonamide (PubChem CID 106158843) has the molecular formula C10H18ClN3O2S and a molecular weight of 279.79 g/mol. Its IUPAC name is N-(5-chloro-4-methylpentyl)-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-(5-chloro-4-methylpentyl)-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106158843 |
| Molecular Formula | C10H18ClN3O2S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-(5-chloro-4-methylpentyl)-2-methylpyrazole-3-sulfonamide |
| SMILES | CC(CCl)CCCNS(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C10H18ClN3O2S/c1-9(8-11)4-3-6-13-17(15,16)10-5-7-12-14(10)2/h5,7,9,13H,3-4,6,8H2,1-2H3 |
| InChIKey | GWZFTTHMTQAQNW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|