C9H18N4O2S — CID 104710232
2-methyl-N-[2-(propan-2-ylamino)ethyl]pyrazole-3-sulfonamide (PubChem CID 104710232) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-methyl-N-[2-(propan-2-ylamino)ethyl]pyrazole-3-sulfonamide.
| Compound Name | 2-methyl-N-[2-(propan-2-ylamino)ethyl]pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104710232 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-methyl-N-[2-(propan-2-ylamino)ethyl]pyrazole-3-sulfonamide |
| SMILES | CC(C)NCCNS(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C9H18N4O2S/c1-8(2)10-6-7-12-16(14,15)9-4-5-11-13(9)3/h4-5,8,10,12H,6-7H2,1-3H3 |
| InChIKey | ZOTLYQDQJMXYPC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|