C6H10N4O3S — CID 104709783
2-[(2-methylpyrazol-3-yl)sulfonylamino]acetamide (PubChem CID 104709783) has the molecular formula C6H10N4O3S and a molecular weight of 218.24 g/mol. Its IUPAC name is 2-[(2-methylpyrazol-3-yl)sulfonylamino]acetamide.
| Compound Name | 2-[(2-methylpyrazol-3-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 104709783 |
| Molecular Formula | C6H10N4O3S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-[(2-methylpyrazol-3-yl)sulfonylamino]acetamide |
| SMILES | Cn1nccc1S(=O)(=O)NCC(N)=O |
| InChI | InChI=1S/C6H10N4O3S/c1-10-6(2-3-8-10)14(12,13)9-4-5(7)11/h2-3,9H,4H2,1H3,(H2,7,11) |
| InChIKey | HHQLZIUQLJLPLF-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |