C11H14F2N4O — CID 112676097
2-[(3,5-difluoro-2-pyridinyl)amino]-1-piperazin-1-ylethanone (PubChem CID 112676097) has the molecular formula C11H14F2N4O and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[(3,5-difluoro-2-pyridinyl)amino]-1-piperazin-1-ylethanone.
| Compound Name | 2-[(3,5-difluoro-2-pyridinyl)amino]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 112676097 |
| Molecular Formula | C11H14F2N4O |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[(3,5-difluoro-2-pyridinyl)amino]-1-piperazin-1-ylethanone |
| SMILES | O=C(CNc1ncc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C11H14F2N4O/c12-8-5-9(13)11(15-6-8)16-7-10(18)17-3-1-14-2-4-17/h5-6,14H,1-4,7H2,(H,15,16) |
| InChIKey | ZQCBNPJOCXGFJX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |