C13H15ClF3N3O — CID 71891929
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-piperidin-1-ylethanone (PubChem CID 71891929) has the molecular formula C13H15ClF3N3O and a molecular weight of 321.73 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 71891929 |
| Molecular Formula | C13H15ClF3N3O |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-1-piperidin-1-ylethanone |
| SMILES | O=C(CNc1ncc(C(F)(F)F)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C13H15ClF3N3O/c14-10-6-9(13(15,16)17)7-18-12(10)19-8-11(21)20-4-2-1-3-5-20/h6-7H,1-5,8H2,(H,18,19) |
| InChIKey | XAUMLNDDCIOGMD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |