C14H16ClF3N2O — CID 60694052
2-[2-chloro-4-(trifluoromethyl)anilino]-1-piperidin-1-ylethanone (PubChem CID 60694052) has the molecular formula C14H16ClF3N2O and a molecular weight of 320.74 g/mol. Its IUPAC name is 2-[2-chloro-4-(trifluoromethyl)anilino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 60694052 |
| Molecular Formula | C14H16ClF3N2O |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-1-piperidin-1-ylethanone |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C14H16ClF3N2O/c15-11-8-10(14(16,17)18)4-5-12(11)19-9-13(21)20-6-2-1-3-7-20/h4-5,8,19H,1-3,6-7,9H2 |
| InChIKey | HDEPVBDPVYIPDA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |