C12H11ClF3NO2 — CID 103250830
(Z)-4-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbut-2-enoic acid (PubChem CID 103250830) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is (Z)-4-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbut-2-enoic acid.
| Compound Name | (Z)-4-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103250830 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (Z)-4-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)CNc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H11ClF3NO2/c1-7(4-11(18)19)6-17-10-3-2-8(5-9(10)13)12(14,15)16/h2-5,17H,6H2,1H3,(H,18,19)/b7-4- |
| InChIKey | QJKHSYIVYBXLJA-DAXSKMNVSA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|