C12H14FNO2 — CID 103235726
(Z)-4-(5-fluoro-2-methylanilino)-3-methylbut-2-enoic acid (PubChem CID 103235726) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is (Z)-4-(5-fluoro-2-methylanilino)-3-methylbut-2-enoic acid.
| Compound Name | (Z)-4-(5-fluoro-2-methylanilino)-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103235726 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (Z)-4-(5-fluoro-2-methylanilino)-3-methylbut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)CNc1cc(F)ccc1C |
| InChI | InChI=1S/C12H14FNO2/c1-8(5-12(15)16)7-14-11-6-10(13)4-3-9(11)2/h3-6,14H,7H2,1-2H3,(H,15,16)/b8-5- |
| InChIKey | VGRPSGSSTSPTGZ-YVMONPNESA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|