C11H11Cl2NO2 — CID 103233560
(Z)-4-(3,4-dichloroanilino)-3-methylbut-2-enoic acid (PubChem CID 103233560) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is (Z)-4-(3,4-dichloroanilino)-3-methylbut-2-enoic acid.
| Compound Name | (Z)-4-(3,4-dichloroanilino)-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103233560 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (Z)-4-(3,4-dichloroanilino)-3-methylbut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)CNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO2/c1-7(4-11(15)16)6-14-8-2-3-9(12)10(13)5-8/h2-5,14H,6H2,1H3,(H,15,16)/b7-4- |
| InChIKey | CEWYUSHPYQMEQW-DAXSKMNVSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|