C13H18ClF3N2 — CID 107445058
N'-tert-butyl-N-[2-chloro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 107445058) has the molecular formula C13H18ClF3N2 and a molecular weight of 294.75 g/mol. Its IUPAC name is N'-tert-butyl-N-[2-chloro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[2-chloro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107445058 |
| Molecular Formula | C13H18ClF3N2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N'-tert-butyl-N-[2-chloro-4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H18ClF3N2/c1-12(2,3)19-7-6-18-11-5-4-9(8-10(11)14)13(15,16)17/h4-5,8,18-19H,6-7H2,1-3H3 |
| InChIKey | OJNJGOYZRNAJKD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|