C13H17ClF3NO — CID 106452025
2-chloro-N-[2-(2-methylpropoxy)ethyl]-4-(trifluoromethyl)aniline (PubChem CID 106452025) has the molecular formula C13H17ClF3NO and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methylpropoxy)ethyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-[2-(2-methylpropoxy)ethyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106452025 |
| Molecular Formula | C13H17ClF3NO |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-chloro-N-[2-(2-methylpropoxy)ethyl]-4-(trifluoromethyl)aniline |
| SMILES | CC(C)COCCNc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H17ClF3NO/c1-9(2)8-19-6-5-18-12-4-3-10(7-11(12)14)13(15,16)17/h3-4,7,9,18H,5-6,8H2,1-2H3 |
| InChIKey | NSDXOSREBCCELN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|