C12H15ClF3N — CID 43714527
2-chloro-N-(2-methylbutyl)-4-(trifluoromethyl)aniline (PubChem CID 43714527) has the molecular formula C12H15ClF3N and a molecular weight of 265.71 g/mol. Its IUPAC name is 2-chloro-N-(2-methylbutyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-(2-methylbutyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43714527 |
| Molecular Formula | C12H15ClF3N |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-chloro-N-(2-methylbutyl)-4-(trifluoromethyl)aniline |
| SMILES | CCC(C)CNc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H15ClF3N/c1-3-8(2)7-17-11-5-4-9(6-10(11)13)12(14,15)16/h4-6,8,17H,3,7H2,1-2H3 |
| InChIKey | HUKLXJUYUDIEQD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |