C9H6ClF3INO — CID 166140537
N-[2-chloro-4-(trifluoromethyl)phenyl]-2-iodoacetamide (PubChem CID 166140537) has the molecular formula C9H6ClF3INO and a molecular weight of 363.50 g/mol. Its IUPAC name is N-[2-chloro-4-(trifluoromethyl)phenyl]-2-iodoacetamide.
| Compound Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-2-iodoacetamide |
|---|---|
| PubChem CID | 166140537 |
| Molecular Formula | C9H6ClF3INO |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-2-iodoacetamide |
| SMILES | O=C(CI)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H6ClF3INO/c10-6-3-5(9(11,12)13)1-2-7(6)15-8(16)4-14/h1-3H,4H2,(H,15,16) |
| InChIKey | ORZRGZCXVQOFJF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|