C15H11ClF3NO — CID 17102273
N-[2-chloro-4-(trifluoromethyl)phenyl]-2-phenylacetamide (PubChem CID 17102273) has the molecular formula C15H11ClF3NO and a molecular weight of 313.71 g/mol. Its IUPAC name is N-[2-chloro-4-(trifluoromethyl)phenyl]-2-phenylacetamide.
| Compound Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 17102273 |
| Molecular Formula | C15H11ClF3NO |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H11ClF3NO/c16-12-9-11(15(17,18)19)6-7-13(12)20-14(21)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,20,21) |
| InChIKey | ANEYKEKPSMDELS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |