C17H14ClF3N2O2 — CID 113000074
N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-phenylacetamide (PubChem CID 113000074) has the molecular formula C17H14ClF3N2O2 and a molecular weight of 370.76 g/mol. Its IUPAC name is N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 113000074 |
| Molecular Formula | C17H14ClF3N2O2 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H14ClF3N2O2/c18-13-7-6-12(17(19,20)21)9-14(13)23-16(25)10-22-15(24)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H,22,24)(H,23,25) |
| InChIKey | ZQVOLNIEMPEFPN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |