C16H14Cl2N2O2 — CID 2449630
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-phenylacetamide (PubChem CID 2449630) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 2449630 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O2/c17-12-6-7-13(18)14(9-12)20-16(22)10-19-15(21)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H,19,21)(H,20,22) |
| InChIKey | JQIGFLMRZQOSOT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |