C16H12Cl4N2O2 — CID 7936906
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 7936906) has the molecular formula C16H12Cl4N2O2 and a molecular weight of 406.10 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7936906 |
| Molecular Formula | C16H12Cl4N2O2 |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H12Cl4N2O2/c17-9-4-5-13(20)14(6-9)22-16(24)8-21-15(23)7-10-11(18)2-1-3-12(10)19/h1-6H,7-8H2,(H,21,23)(H,22,24) |
| InChIKey | KYDXYMHQRUYVAI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |