C21H17Cl3N2O — CID 2538159
N-[2-(benzylamino)-5-chlorophenyl]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 2538159) has the molecular formula C21H17Cl3N2O and a molecular weight of 419.74 g/mol. Its IUPAC name is N-[2-(benzylamino)-5-chlorophenyl]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[2-(benzylamino)-5-chlorophenyl]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2538159 |
| Molecular Formula | C21H17Cl3N2O |
| Molecular Weight | 419.74 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[2-(benzylamino)-5-chlorophenyl]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)Nc1cc(Cl)ccc1NCc1ccccc1 |
| InChI | InChI=1S/C21H17Cl3N2O/c22-15-9-10-19(25-13-14-5-2-1-3-6-14)20(11-15)26-21(27)12-16-17(23)7-4-8-18(16)24/h1-11,25H,12-13H2,(H,26,27) |
| InChIKey | LMBRUCPTEMPVKD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |