C13H18Cl3N3O2 — CID 119683791
N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119683791) has the molecular formula C13H18Cl3N3O2 and a molecular weight of 354.67 g/mol. Its IUPAC name is N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119683791 |
| Molecular Formula | C13H18Cl3N3O2 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[2-(2,5-dichloroanilino)-2-oxoethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCC(=O)Nc1cc(Cl)ccc1Cl.Cl |
| InChI | InChI=1S/C13H17Cl2N3O2.ClH/c1-16-6-2-3-12(19)17-8-13(20)18-11-7-9(14)4-5-10(11)15;/h4-5,7,16H,2-3,6,8H2,1H3,(H,17,19)(H,18,20);1H |
| InChIKey | HQAUWYCVCUZWOE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|