C14H20ClN3O2 — CID 119714153
4-chloro-N-ethyl-2-[4-(methylamino)butanoylamino]benzamide (PubChem CID 119714153) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-chloro-N-ethyl-2-[4-(methylamino)butanoylamino]benzamide.
| Compound Name | 4-chloro-N-ethyl-2-[4-(methylamino)butanoylamino]benzamide |
|---|---|
| PubChem CID | 119714153 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-chloro-N-ethyl-2-[4-(methylamino)butanoylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(Cl)cc1NC(=O)CCCNC |
| InChI | InChI=1S/C14H20ClN3O2/c1-3-17-14(20)11-7-6-10(15)9-12(11)18-13(19)5-4-8-16-2/h6-7,9,16H,3-5,8H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | PJOODRIGQIVDPA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|