C16H21ClN2O4 — CID 51088112
5-[5-chloro-2-(ethylcarbamoyl)anilino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 51088112) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is 5-[5-chloro-2-(ethylcarbamoyl)anilino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[5-chloro-2-(ethylcarbamoyl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 51088112 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-[5-chloro-2-(ethylcarbamoyl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCNC(=O)c1ccc(Cl)cc1NC(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C16H21ClN2O4/c1-4-18-15(23)11-6-5-10(17)7-12(11)19-13(20)8-16(2,3)9-14(21)22/h5-7H,4,8-9H2,1-3H3,(H,18,23)(H,19,20)(H,21,22) |
| InChIKey | OOPZFSIJGFXACB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |