C17H20ClN3O3 — CID 119433464
N-[5-chloro-2-[3-(methylamino)propylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide (PubChem CID 119433464) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is N-[5-chloro-2-[3-(methylamino)propylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[5-chloro-2-[3-(methylamino)propylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 119433464 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[5-chloro-2-[3-(methylamino)propylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide |
| SMILES | CNCCCNC(=O)c1ccc(Cl)cc1NC(=O)c1ccoc1C |
| InChI | InChI=1S/C17H20ClN3O3/c1-11-13(6-9-24-11)17(23)21-15-10-12(18)4-5-14(15)16(22)20-8-3-7-19-2/h4-6,9-10,19H,3,7-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | LNGNUNOJSDXQFS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|