C17H21Cl2N3O3 — CID 119508711
N-[5-chloro-2-[2-(ethylamino)ethylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide;hydrochloride (PubChem CID 119508711) has the molecular formula C17H21Cl2N3O3 and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[5-chloro-2-[2-(ethylamino)ethylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide;hydrochloride.
| Compound Name | N-[5-chloro-2-[2-(ethylamino)ethylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119508711 |
| Molecular Formula | C17H21Cl2N3O3 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[5-chloro-2-[2-(ethylamino)ethylcarbamoyl]phenyl]-2-methylfuran-3-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccc(Cl)cc1NC(=O)c1ccoc1C.Cl |
| InChI | InChI=1S/C17H20ClN3O3.ClH/c1-3-19-7-8-20-16(22)14-5-4-12(18)10-15(14)21-17(23)13-6-9-24-11(13)2;/h4-6,9-10,19H,3,7-8H2,1-2H3,(H,20,22)(H,21,23);1H |
| InChIKey | VLSMWIUQLVMMLL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|