C11H15Cl3N2O — CID 119509137
2,4-dichloro-N-[2-(ethylamino)ethyl]benzamide;hydrochloride (PubChem CID 119509137) has the molecular formula C11H15Cl3N2O and a molecular weight of 297.61 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(ethylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 2,4-dichloro-N-[2-(ethylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119509137 |
| Molecular Formula | C11H15Cl3N2O |
| Molecular Weight | 297.61 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2,4-dichloro-N-[2-(ethylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C11H14Cl2N2O.ClH/c1-2-14-5-6-15-11(16)9-4-3-8(12)7-10(9)13;/h3-4,7,14H,2,5-6H2,1H3,(H,15,16);1H |
| InChIKey | TVRKZBACSNSTDX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|