C12H17Cl3N2OS — CID 119506464
2,4-dichloro-N-[2-(ethylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride (PubChem CID 119506464) has the molecular formula C12H17Cl3N2OS and a molecular weight of 343.71 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(ethylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride.
| Compound Name | 2,4-dichloro-N-[2-(ethylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119506464 |
| Molecular Formula | C12H17Cl3N2OS |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2,4-dichloro-N-[2-(ethylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cc(SC)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C12H16Cl2N2OS.ClH/c1-3-15-4-5-16-12(17)8-6-11(18-2)10(14)7-9(8)13;/h6-7,15H,3-5H2,1-2H3,(H,16,17);1H |
| InChIKey | FOLIVKHHLVKKHI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|