C11H11Cl2NO3S — CID 59888546
methyl 2-[(2,5-dichloro-4-methylsulfanylbenzoyl)amino]acetate (PubChem CID 59888546) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is methyl 2-[(2,5-dichloro-4-methylsulfanylbenzoyl)amino]acetate.
| Compound Name | methyl 2-[(2,5-dichloro-4-methylsulfanylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 59888546 |
| Molecular Formula | C11H11Cl2NO3S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | methyl 2-[(2,5-dichloro-4-methylsulfanylbenzoyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc(Cl)c(SC)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3S/c1-17-10(15)5-14-11(16)6-3-8(13)9(18-2)4-7(6)12/h3-4H,5H2,1-2H3,(H,14,16) |
| InChIKey | FORDXBWGQXQHEH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |