C12H16Cl2N2OS — CID 119431280
2,4-dichloro-N-[3-(methylamino)propyl]-5-methylsulfanylbenzamide (PubChem CID 119431280) has the molecular formula C12H16Cl2N2OS and a molecular weight of 307.25 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(methylamino)propyl]-5-methylsulfanylbenzamide.
| Compound Name | 2,4-dichloro-N-[3-(methylamino)propyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 119431280 |
| Molecular Formula | C12H16Cl2N2OS |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2,4-dichloro-N-[3-(methylamino)propyl]-5-methylsulfanylbenzamide |
| SMILES | CNCCCNC(=O)c1cc(SC)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2OS/c1-15-4-3-5-16-12(17)8-6-11(18-2)10(14)7-9(8)13/h6-7,15H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | KDNRCXHLSNTJTQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|