C12H11Cl2N3O2 — CID 108570422
2,4-dichloro-N-[2-[(2-cyanoacetyl)amino]ethyl]benzamide (PubChem CID 108570422) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(2-cyanoacetyl)amino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[(2-cyanoacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108570422 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2,4-dichloro-N-[2-[(2-cyanoacetyl)amino]ethyl]benzamide |
| SMILES | N#CCC(=O)NCCNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O2/c13-8-1-2-9(10(14)7-8)12(19)17-6-5-16-11(18)3-4-15/h1-2,7H,3,5-6H2,(H,16,18)(H,17,19) |
| InChIKey | YXWNAAHXQZHNIA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|