C13H13Cl2N3O2 — CID 108924318
2,5-dichloro-N-[3-[(2-cyanoacetyl)amino]propyl]benzamide (PubChem CID 108924318) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-[(2-cyanoacetyl)amino]propyl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-[(2-cyanoacetyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 108924318 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2,5-dichloro-N-[3-[(2-cyanoacetyl)amino]propyl]benzamide |
| SMILES | N#CCC(=O)NCCCNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O2/c14-9-2-3-11(15)10(8-9)13(20)18-7-1-6-17-12(19)4-5-16/h2-3,8H,1,4,6-7H2,(H,17,19)(H,18,20) |
| InChIKey | YJZLOKROWOUNLP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|