C17H13Cl2F3N2O2 — CID 34496955
2,4-dichloro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]benzamide (PubChem CID 34496955) has the molecular formula C17H13Cl2F3N2O2 and a molecular weight of 405.20 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 34496955 |
| Molecular Formula | C17H13Cl2F3N2O2 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2,4-dichloro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)cc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13Cl2F3N2O2/c18-12-5-6-13(14(19)9-12)16(26)24-8-7-23-15(25)10-1-3-11(4-2-10)17(20,21)22/h1-6,9H,7-8H2,(H,23,25)(H,24,26) |
| InChIKey | JWDCMZDOZWJODW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|