C17H14ClF3N2O2 — CID 113000065
N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-4-methylbenzamide (PubChem CID 113000065) has the molecular formula C17H14ClF3N2O2 and a molecular weight of 370.76 g/mol. Its IUPAC name is N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-4-methylbenzamide.
| Compound Name | N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 113000065 |
| Molecular Formula | C17H14ClF3N2O2 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H14ClF3N2O2/c1-10-2-4-11(5-3-10)16(25)22-9-15(24)23-14-8-12(17(19,20)21)6-7-13(14)18/h2-8H,9H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | RCCQZJHIMVPVKF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |