C15H10ClF3N2OS — CID 17100502
N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 17100502) has the molecular formula C15H10ClF3N2OS and a molecular weight of 358.77 g/mol. Its IUPAC name is N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17100502 |
| Molecular Formula | C15H10ClF3N2OS |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(C(F)(F)F)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H10ClF3N2OS/c16-11-8-10(15(17,18)19)6-7-12(11)20-14(23)21-13(22)9-4-2-1-3-5-9/h1-8H,(H2,20,21,22,23) |
| InChIKey | UIBQVCBUJZMTLU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|