C16H11ClF3N3O3S — CID 22776906
N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide (PubChem CID 22776906) has the molecular formula C16H11ClF3N3O3S and a molecular weight of 417.80 g/mol. Its IUPAC name is N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 22776906 |
| Molecular Formula | C16H11ClF3N3O3S |
| Molecular Weight | 417.80 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)NC(=S)Nc2ccc(C(F)(F)F)cc2Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3N3O3S/c1-8-10(3-2-4-13(8)23(25)26)14(24)22-15(27)21-12-6-5-9(7-11(12)17)16(18,19)20/h2-7H,1H3,(H2,21,22,24,27) |
| InChIKey | YMPFJZRYKSMCJX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|