3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid

C15H10Cl2N2O3S — CID 91688333

IUPAC3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid
SMILESO=C(O)c1cc(Cl)c(Cl)c(NC(=S)NC(=O)c2ccccc2)c1
InChIInChI=1S/C15H10Cl2N2O3S/c16-10-6-9(14(21)22)7-11(12(10)17)18-15(23)19-13(20)8-4-2-1-3-5-8/h1-7H,(H,21,22)(H2,18,19,20,23)
InChIKeyODTGWBHFLNLWQW-UHFFFAOYSA-N
MW369.23 g/mol
LogP3.82
Rot. Bonds3

About 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid

3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid (PubChem CID 91688333) has the molecular formula C15H10Cl2N2O3S and a molecular weight of 369.23 g/mol. Its IUPAC name is 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid.

Molecular Properties

Compound Name3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid
PubChem CID91688333
Molecular FormulaC15H10Cl2N2O3S
Molecular Weight369.23 g/mol
Exact Mass367.98
IUPAC Name3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid
SMILESO=C(O)c1cc(Cl)c(Cl)c(NC(=S)NC(=O)c2ccccc2)c1
InChIInChI=1S/C15H10Cl2N2O3S/c16-10-6-9(14(21)22)7-11(12(10)17)18-15(23)19-13(20)8-4-2-1-3-5-8/h1-7H,(H,21,22)(H2,18,19,20,23)
InChIKeyODTGWBHFLNLWQW-UHFFFAOYSA-N
XLogP3.82
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500369.23
LogP ≤ 53.82
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid?
The IUPAC name of 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid (CID 91688333) is 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid.
What is the SMILES notation for 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid?
The canonical SMILES for 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid is O=C(O)c1cc(Cl)c(Cl)c(NC(=S)NC(=O)c2ccccc2)c1.
What is the InChIKey of 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid?
The InChIKey is ODTGWBHFLNLWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N2O3S/c16-10-6-9(14(21)22)7-11(12(10)17)18-15(23)19-13(20)8-4-2-1-3-5-8/h1-7H,(H,21,22)(H2,18,19,20,23).
What are the key properties of 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid?
3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid has a molecular weight of 369.23 g/mol, XLogP of 3.82, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzoylcarbamothioylamino)-4,5-dichlorobenzoic acid is sourced from PubChem (CID 91688333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).